C14H25N3O2 — CID 83226023
tert-butyl 2-amino-3-(1,3-diethylpyrazol-5-yl)propanoate (PubChem CID 83226023) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl 2-amino-3-(1,3-diethylpyrazol-5-yl)propanoate.
| Compound Name | tert-butyl 2-amino-3-(1,3-diethylpyrazol-5-yl)propanoate |
|---|---|
| PubChem CID | 83226023 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | tert-butyl 2-amino-3-(1,3-diethylpyrazol-5-yl)propanoate |
| SMILES | CCc1cc(CC(N)C(=O)OC(C)(C)C)n(CC)n1 |
| InChI | InChI=1S/C14H25N3O2/c1-6-10-8-11(17(7-2)16-10)9-12(15)13(18)19-14(3,4)5/h8,12H,6-7,9,15H2,1-5H3 |
| InChIKey | XETQBCQUVVJLLU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |