C12H19N3O3 — CID 114899899
3-amino-2-[(1,3-diethylpyrazol-5-yl)methyl]-2-methyl-3-oxopropanoic acid (PubChem CID 114899899) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-amino-2-[(1,3-diethylpyrazol-5-yl)methyl]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-amino-2-[(1,3-diethylpyrazol-5-yl)methyl]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114899899 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-amino-2-[(1,3-diethylpyrazol-5-yl)methyl]-2-methyl-3-oxopropanoic acid |
| SMILES | CCc1cc(CC(C)(C(N)=O)C(=O)O)n(CC)n1 |
| InChI | InChI=1S/C12H19N3O3/c1-4-8-6-9(15(5-2)14-8)7-12(3,10(13)16)11(17)18/h6H,4-5,7H2,1-3H3,(H2,13,16)(H,17,18) |
| InChIKey | MKFMEWUISDOBER-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|