C15H18Br2N2O — CID 107947608
1-(2,4-dibromophenyl)-2-(1,3-diethylpyrazol-5-yl)ethanol (PubChem CID 107947608) has the molecular formula C15H18Br2N2O and a molecular weight of 402.13 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-2-(1,3-diethylpyrazol-5-yl)ethanol.
| Compound Name | 1-(2,4-dibromophenyl)-2-(1,3-diethylpyrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 107947608 |
| Molecular Formula | C15H18Br2N2O |
| Molecular Weight | 402.13 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | 1-(2,4-dibromophenyl)-2-(1,3-diethylpyrazol-5-yl)ethanol |
| SMILES | CCc1cc(CC(O)c2ccc(Br)cc2Br)n(CC)n1 |
| InChI | InChI=1S/C15H18Br2N2O/c1-3-11-8-12(19(4-2)18-11)9-15(20)13-6-5-10(16)7-14(13)17/h5-8,15,20H,3-4,9H2,1-2H3 |
| InChIKey | MKOKLFIFMIBVQK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.13 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |