C16H20Br2N2 — CID 79455109
5-[3-bromo-2-(2-bromophenyl)propyl]-1,3-diethylpyrazole (PubChem CID 79455109) has the molecular formula C16H20Br2N2 and a molecular weight of 400.16 g/mol. Its IUPAC name is 5-[3-bromo-2-(2-bromophenyl)propyl]-1,3-diethylpyrazole.
| Compound Name | 5-[3-bromo-2-(2-bromophenyl)propyl]-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 79455109 |
| Molecular Formula | C16H20Br2N2 |
| Molecular Weight | 400.16 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 5-[3-bromo-2-(2-bromophenyl)propyl]-1,3-diethylpyrazole |
| SMILES | CCc1cc(CC(CBr)c2ccccc2Br)n(CC)n1 |
| InChI | InChI=1S/C16H20Br2N2/c1-3-13-10-14(20(4-2)19-13)9-12(11-17)15-7-5-6-8-16(15)18/h5-8,10,12H,3-4,9,11H2,1-2H3 |
| InChIKey | AQYSSJCORRPYQJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.16 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|