C16H20Br2N2O — CID 107947554
1-(2,4-dibromophenyl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanol (PubChem CID 107947554) has the molecular formula C16H20Br2N2O and a molecular weight of 416.16 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanol.
| Compound Name | 1-(2,4-dibromophenyl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 107947554 |
| Molecular Formula | C16H20Br2N2O |
| Molecular Weight | 416.16 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 1-(2,4-dibromophenyl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanol |
| SMILES | CCC(CC)n1ccc(CC(O)c2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C16H20Br2N2O/c1-3-13(4-2)20-8-7-12(19-20)10-16(21)14-6-5-11(17)9-15(14)18/h5-9,13,16,21H,3-4,10H2,1-2H3 |
| InChIKey | GKVFSPKWJQSXAH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.16 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |