C16H18Br2N2O — CID 114976211
1-(2,5-dibromophenyl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanone (PubChem CID 114976211) has the molecular formula C16H18Br2N2O and a molecular weight of 414.14 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanone.
| Compound Name | 1-(2,5-dibromophenyl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanone |
|---|---|
| PubChem CID | 114976211 |
| Molecular Formula | C16H18Br2N2O |
| Molecular Weight | 414.14 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | 1-(2,5-dibromophenyl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanone |
| SMILES | CCC(CC)n1ccc(CC(=O)c2cc(Br)ccc2Br)n1 |
| InChI | InChI=1S/C16H18Br2N2O/c1-3-13(4-2)20-8-7-12(19-20)10-16(21)14-9-11(17)5-6-15(14)18/h5-9,13H,3-4,10H2,1-2H3 |
| InChIKey | KGMPSPLVXHLMFZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.14 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |