C14H17BrF3N3 — CID 107488209
N-(2-bromoethyl)-N-[(1-ethylindazol-3-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 107488209) has the molecular formula C14H17BrF3N3 and a molecular weight of 364.21 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(1-ethylindazol-3-yl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(1-ethylindazol-3-yl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107488209 |
| Molecular Formula | C14H17BrF3N3 |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-(2-bromoethyl)-N-[(1-ethylindazol-3-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | CCn1nc(CN(CCBr)CC(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C14H17BrF3N3/c1-2-21-13-6-4-3-5-11(13)12(19-21)9-20(8-7-15)10-14(16,17)18/h3-6H,2,7-10H2,1H3 |
| InChIKey | WKFRZNSFJDIZOS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|