C15H22FN3 — CID 112567902
2-[(1-ethylindazol-3-yl)methyl]-2-fluoropentan-1-amine (PubChem CID 112567902) has the molecular formula C15H22FN3 and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-[(1-ethylindazol-3-yl)methyl]-2-fluoropentan-1-amine.
| Compound Name | 2-[(1-ethylindazol-3-yl)methyl]-2-fluoropentan-1-amine |
|---|---|
| PubChem CID | 112567902 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 2-[(1-ethylindazol-3-yl)methyl]-2-fluoropentan-1-amine |
| SMILES | CCCC(F)(CN)Cc1nn(CC)c2ccccc12 |
| InChI | InChI=1S/C15H22FN3/c1-3-9-15(16,11-17)10-13-12-7-5-6-8-14(12)19(4-2)18-13/h5-8H,3-4,9-11,17H2,1-2H3 |
| InChIKey | XWUUHKNVBBVQEV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |