C14H18F4O2 — CID 103474191
1-(2,5-dimethylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 103474191) has the molecular formula C14H18F4O2 and a molecular weight of 294.29 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 103474191 |
| Molecular Formula | C14H18F4O2 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | Cc1ccc(C)c(CC(O)COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C14H18F4O2/c1-9-3-4-10(2)11(5-9)6-12(19)7-20-8-14(17,18)13(15)16/h3-5,12-13,19H,6-8H2,1-2H3 |
| InChIKey | MVGIEWRHNNCVPZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|