C12H18O — CID 94208295
(2R)-1-(2,5-dimethylphenyl)butan-2-ol (PubChem CID 94208295) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (2R)-1-(2,5-dimethylphenyl)butan-2-ol.
| Compound Name | (2R)-1-(2,5-dimethylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 94208295 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (2R)-1-(2,5-dimethylphenyl)butan-2-ol |
| SMILES | CC[C@@H](O)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C12H18O/c1-4-12(13)8-11-7-9(2)5-6-10(11)3/h5-7,12-13H,4,8H2,1-3H3/t12-/m1/s1 |
| InChIKey | ZIJRUMXIXDAINH-GFCCVEGCSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |