C14H22O2 — CID 65091903
1-(2,5-dimethylphenyl)-5-methoxypentan-2-ol (PubChem CID 65091903) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-5-methoxypentan-2-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-5-methoxypentan-2-ol |
|---|---|
| PubChem CID | 65091903 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-5-methoxypentan-2-ol |
| SMILES | COCCCC(O)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C14H22O2/c1-11-6-7-12(2)13(9-11)10-14(15)5-4-8-16-3/h6-7,9,14-15H,4-5,8,10H2,1-3H3 |
| InChIKey | USAPURWHNWJDGH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|