C12H16ClFO2 — CID 112653463
1-(2-chloro-3-fluorophenyl)-5-methoxypentan-2-ol (PubChem CID 112653463) has the molecular formula C12H16ClFO2 and a molecular weight of 246.71 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-5-methoxypentan-2-ol.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-5-methoxypentan-2-ol |
|---|---|
| PubChem CID | 112653463 |
| Molecular Formula | C12H16ClFO2 |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-5-methoxypentan-2-ol |
| SMILES | COCCCC(O)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C12H16ClFO2/c1-16-7-3-5-10(15)8-9-4-2-6-11(14)12(9)13/h2,4,6,10,15H,3,5,7-8H2,1H3 |
| InChIKey | WDWIZQGTJMOLSL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|