C13H19ClO3 — CID 65091964
1-(5-chloro-2-methoxyphenyl)-5-methoxypentan-2-ol (PubChem CID 65091964) has the molecular formula C13H19ClO3 and a molecular weight of 258.74 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-5-methoxypentan-2-ol.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-5-methoxypentan-2-ol |
|---|---|
| PubChem CID | 65091964 |
| Molecular Formula | C13H19ClO3 |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-5-methoxypentan-2-ol |
| SMILES | COCCCC(O)Cc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C13H19ClO3/c1-16-7-3-4-12(15)9-10-8-11(14)5-6-13(10)17-2/h5-6,8,12,15H,3-4,7,9H2,1-2H3 |
| InChIKey | CZEAYAMEXFWCAQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|