C12H17ClO2S — CID 65148808
1-(5-chloro-2-methoxyphenyl)-4-methylsulfanylbutan-2-ol (PubChem CID 65148808) has the molecular formula C12H17ClO2S and a molecular weight of 260.79 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-4-methylsulfanylbutan-2-ol.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-4-methylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 65148808 |
| Molecular Formula | C12H17ClO2S |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-4-methylsulfanylbutan-2-ol |
| SMILES | COc1ccc(Cl)cc1CC(O)CCSC |
| InChI | InChI=1S/C12H17ClO2S/c1-15-12-4-3-10(13)7-9(12)8-11(14)5-6-16-2/h3-4,7,11,14H,5-6,8H2,1-2H3 |
| InChIKey | GDAIQGWVFCQMTK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |