C13H19ClO2 — CID 62606334
1-(5-chloro-2-methoxyphenyl)-3,3-dimethylbutan-2-ol (PubChem CID 62606334) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3,3-dimethylbutan-2-ol.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 62606334 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3,3-dimethylbutan-2-ol |
| SMILES | COc1ccc(Cl)cc1CC(O)C(C)(C)C |
| InChI | InChI=1S/C13H19ClO2/c1-13(2,3)12(15)8-9-7-10(14)5-6-11(9)16-4/h5-7,12,15H,8H2,1-4H3 |
| InChIKey | GSVGEYQGXNCSKP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |