C12H18ClNO — CID 62602017
1-(5-chloro-2-methoxyphenyl)-3-methylbutan-2-amine (PubChem CID 62602017) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-methylbutan-2-amine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 62602017 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-methylbutan-2-amine |
| SMILES | COc1ccc(Cl)cc1CC(N)C(C)C |
| InChI | InChI=1S/C12H18ClNO/c1-8(2)11(14)7-9-6-10(13)4-5-12(9)15-3/h4-6,8,11H,7,14H2,1-3H3 |
| InChIKey | WKJBWYJRDAEIPO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |