C15H13Cl2FO2 — CID 63083648
1-(4-chloro-2-fluorophenyl)-2-(5-chloro-2-methoxyphenyl)ethanol (PubChem CID 63083648) has the molecular formula C15H13Cl2FO2 and a molecular weight of 315.17 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-2-(5-chloro-2-methoxyphenyl)ethanol.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-2-(5-chloro-2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 63083648 |
| Molecular Formula | C15H13Cl2FO2 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-2-(5-chloro-2-methoxyphenyl)ethanol |
| SMILES | COc1ccc(Cl)cc1CC(O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H13Cl2FO2/c1-20-15-5-3-10(16)6-9(15)7-14(19)12-4-2-11(17)8-13(12)18/h2-6,8,14,19H,7H2,1H3 |
| InChIKey | CYFLRUHEBADWKF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |