C15H12ClF3O2 — CID 115788665
2-(5-chloro-2-methoxyphenyl)-1-(2,3,4-trifluorophenyl)ethanol (PubChem CID 115788665) has the molecular formula C15H12ClF3O2 and a molecular weight of 316.71 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-1-(2,3,4-trifluorophenyl)ethanol.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-1-(2,3,4-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 115788665 |
| Molecular Formula | C15H12ClF3O2 |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-1-(2,3,4-trifluorophenyl)ethanol |
| SMILES | COc1ccc(Cl)cc1CC(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H12ClF3O2/c1-21-13-5-2-9(16)6-8(13)7-12(20)10-3-4-11(17)15(19)14(10)18/h2-6,12,20H,7H2,1H3 |
| InChIKey | RRRTVYRYOZJPSM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|