C12H18O3S — CID 62472724
1-(2,5-dimethylphenyl)-3-methylsulfonylpropan-2-ol (PubChem CID 62472724) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-methylsulfonylpropan-2-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-3-methylsulfonylpropan-2-ol |
|---|---|
| PubChem CID | 62472724 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-methylsulfonylpropan-2-ol |
| SMILES | Cc1ccc(C)c(CC(O)CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H18O3S/c1-9-4-5-10(2)11(6-9)7-12(13)8-16(3,14)15/h4-6,12-13H,7-8H2,1-3H3 |
| InChIKey | MHBTVTAVTVWWKT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |