C10H11ClF4O2S — CID 103474045
1-(5-chlorothiophen-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 103474045) has the molecular formula C10H11ClF4O2S and a molecular weight of 306.71 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 103474045 |
| Molecular Formula | C10H11ClF4O2S |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)F)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H11ClF4O2S/c11-8-2-1-7(18-8)3-6(16)4-17-5-10(14,15)9(12)13/h1-2,6,9,16H,3-5H2 |
| InChIKey | GBKDWJJVDUMECY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|