C10H13F4NO2S — CID 103474059
1-(2-methyl-1,3-thiazol-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 103474059) has the molecular formula C10H13F4NO2S and a molecular weight of 287.28 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 103474059 |
| Molecular Formula | C10H13F4NO2S |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | Cc1nc(CC(O)COCC(F)(F)C(F)F)cs1 |
| InChI | InChI=1S/C10H13F4NO2S/c1-6-15-7(4-18-6)2-8(16)3-17-5-10(13,14)9(11)12/h4,8-9,16H,2-3,5H2,1H3 |
| InChIKey | ULUMDFZMHOJOOU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|