C13H15BrF4O3 — CID 103473973
1-(5-bromo-2-methoxyphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 103473973) has the molecular formula C13H15BrF4O3 and a molecular weight of 375.16 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 103473973 |
| Molecular Formula | C13H15BrF4O3 |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | COc1ccc(Br)cc1CC(O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H15BrF4O3/c1-20-11-3-2-9(14)4-8(11)5-10(19)6-21-7-13(17,18)12(15)16/h2-4,10,12,19H,5-7H2,1H3 |
| InChIKey | VRBFLEDHVSOZJI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|