C9H10ClF4NOS — CID 103475112
1-(5-chlorothiophen-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475112) has the molecular formula C9H10ClF4NOS and a molecular weight of 291.70 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475112 |
| Molecular Formula | C9H10ClF4NOS |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | NC(COCC(F)(F)C(F)F)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H10ClF4NOS/c10-7-2-1-6(17-7)5(15)3-16-4-9(13,14)8(11)12/h1-2,5,8H,3-4,15H2 |
| InChIKey | QMUYMUZXDFBPAR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|