C13H21F4NO — CID 106654843
1-(cycloocten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 106654843) has the molecular formula C13H21F4NO and a molecular weight of 283.31 g/mol. Its IUPAC name is 1-(cycloocten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(cycloocten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 106654843 |
| Molecular Formula | C13H21F4NO |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-(cycloocten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | NC(COCC(F)(F)C(F)F)C1=CCCCCCC1 |
| InChI | InChI=1S/C13H21F4NO/c14-12(15)13(16,17)9-19-8-11(18)10-6-4-2-1-3-5-7-10/h6,11-12H,1-5,7-9,18H2 |
| InChIKey | LBHSMRKOPMDHFD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|