C13H18ClF4NOS — CID 103475919
1-(5-chlorothiophen-2-yl)-N-propyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine (PubChem CID 103475919) has the molecular formula C13H18ClF4NOS and a molecular weight of 347.81 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-propyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-propyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
|---|---|
| PubChem CID | 103475919 |
| Molecular Formula | C13H18ClF4NOS |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-propyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
| SMILES | CCCNC(COCC(F)(F)C(F)F)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H18ClF4NOS/c1-2-5-19-9(6-10-3-4-11(14)21-10)7-20-8-13(17,18)12(15)16/h3-4,9,12,19H,2,5-8H2,1H3 |
| InChIKey | NRTITWMLBCPQOS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|