C17H22ClNS — CID 63417307
1-(5-chlorothiophen-2-yl)-4-phenyl-N-propylbutan-2-amine (PubChem CID 63417307) has the molecular formula C17H22ClNS and a molecular weight of 307.89 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-4-phenyl-N-propylbutan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-4-phenyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 63417307 |
| Molecular Formula | C17H22ClNS |
| Molecular Weight | 307.89 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-4-phenyl-N-propylbutan-2-amine |
| SMILES | CCCNC(CCc1ccccc1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C17H22ClNS/c1-2-12-19-15(13-16-10-11-17(18)20-16)9-8-14-6-4-3-5-7-14/h3-7,10-11,15,19H,2,8-9,12-13H2,1H3 |
| InChIKey | WQEFRVFBBHCERA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |