C14H24ClNS — CID 115841697
1-(5-chlorothiophen-2-yl)-4-methyl-N-propylhexan-2-amine (PubChem CID 115841697) has the molecular formula C14H24ClNS and a molecular weight of 273.87 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-4-methyl-N-propylhexan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-4-methyl-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 115841697 |
| Molecular Formula | C14H24ClNS |
| Molecular Weight | 273.87 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-4-methyl-N-propylhexan-2-amine |
| SMILES | CCCNC(Cc1ccc(Cl)s1)CC(C)CC |
| InChI | InChI=1S/C14H24ClNS/c1-4-8-16-12(9-11(3)5-2)10-13-6-7-14(15)17-13/h6-7,11-12,16H,4-5,8-10H2,1-3H3 |
| InChIKey | NKYGLPUCLJMYMX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.87 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |