C15H29F4NO — CID 103475868
N-propyl-1-(2,2,3,3-tetrafluoropropoxy)nonan-2-amine (PubChem CID 103475868) has the molecular formula C15H29F4NO and a molecular weight of 315.39 g/mol. Its IUPAC name is N-propyl-1-(2,2,3,3-tetrafluoropropoxy)nonan-2-amine.
| Compound Name | N-propyl-1-(2,2,3,3-tetrafluoropropoxy)nonan-2-amine |
|---|---|
| PubChem CID | 103475868 |
| Molecular Formula | C15H29F4NO |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-propyl-1-(2,2,3,3-tetrafluoropropoxy)nonan-2-amine |
| SMILES | CCCCCCCC(COCC(F)(F)C(F)F)NCCC |
| InChI | InChI=1S/C15H29F4NO/c1-3-5-6-7-8-9-13(20-10-4-2)11-21-12-15(18,19)14(16)17/h13-14,20H,3-12H2,1-2H3 |
| InChIKey | SAMPJBZGHRCIEY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|