C11H13F4NO — CID 43128661
[4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanamine (PubChem CID 43128661) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is [4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanamine.
| Compound Name | [4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 43128661 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanamine |
| SMILES | NCc1ccc(COCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H13F4NO/c12-10(13)11(14,15)7-17-6-9-3-1-8(5-16)2-4-9/h1-4,10H,5-7,16H2 |
| InChIKey | ZXXDVXQLZVSGAD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|