C11H14ClF4NO2 — CID 164885128
[4-methoxy-3-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine;hydrochloride (PubChem CID 164885128) has the molecular formula C11H14ClF4NO2 and a molecular weight of 303.68 g/mol. Its IUPAC name is [4-methoxy-3-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine;hydrochloride.
| Compound Name | [4-methoxy-3-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 164885128 |
| Molecular Formula | C11H14ClF4NO2 |
| Molecular Weight | 303.68 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [4-methoxy-3-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine;hydrochloride |
| SMILES | COc1ccc(CN)cc1OCC(F)(F)C(F)F.Cl |
| InChI | InChI=1S/C11H13F4NO2.ClH/c1-17-8-3-2-7(5-16)4-9(8)18-6-11(14,15)10(12)13;/h2-4,10H,5-6,16H2,1H3;1H |
| InChIKey | QBTFBQZCJZGULR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|