C10H12ClF4NO — CID 129160857
[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine;hydrochloride (PubChem CID 129160857) has the molecular formula C10H12ClF4NO and a molecular weight of 273.66 g/mol. Its IUPAC name is [3-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine;hydrochloride.
| Compound Name | [3-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 129160857 |
| Molecular Formula | C10H12ClF4NO |
| Molecular Weight | 273.66 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | [3-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cccc(OCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H11F4NO.ClH/c11-9(12)10(13,14)6-16-8-3-1-2-7(4-8)5-15;/h1-4,9H,5-6,15H2;1H |
| InChIKey | MABDUHVEIIPEQT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|