C10H10BrF4NO — CID 102814566
[3-bromo-5-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine (PubChem CID 102814566) has the molecular formula C10H10BrF4NO and a molecular weight of 316.09 g/mol. Its IUPAC name is [3-bromo-5-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine.
| Compound Name | [3-bromo-5-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 102814566 |
| Molecular Formula | C10H10BrF4NO |
| Molecular Weight | 316.09 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | [3-bromo-5-(2,2,3,3-tetrafluoropropoxy)phenyl]methanamine |
| SMILES | NCc1cc(Br)cc(OCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H10BrF4NO/c11-7-1-6(4-16)2-8(3-7)17-5-10(14,15)9(12)13/h1-3,9H,4-5,16H2 |
| InChIKey | RQDOYHLWGWNVNV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.09 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|