C11H12BrF4NO — CID 114069400
(1R)-1-[2-bromo-4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethanamine (PubChem CID 114069400) has the molecular formula C11H12BrF4NO and a molecular weight of 330.12 g/mol. Its IUPAC name is (1R)-1-[2-bromo-4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[2-bromo-4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 114069400 |
| Molecular Formula | C11H12BrF4NO |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | (1R)-1-[2-bromo-4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(OCC(F)(F)C(F)F)cc1Br |
| InChI | InChI=1S/C11H12BrF4NO/c1-6(17)8-3-2-7(4-9(8)12)18-5-11(15,16)10(13)14/h2-4,6,10H,5,17H2,1H3/t6-/m1/s1 |
| InChIKey | XRGDBXUWADECJA-ZCFIWIBFSA-N |
| XLogP | 3.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|