C11H6F4N2O — CID 4197247
4-(2,2,3,3-tetrafluoropropoxy)benzene-1,2-dicarbonitrile (PubChem CID 4197247) has the molecular formula C11H6F4N2O and a molecular weight of 258.17 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(2,2,3,3-tetrafluoropropoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 4197247 |
| Molecular Formula | C11H6F4N2O |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(OCC(F)(F)C(F)F)cc1C#N |
| InChI | InChI=1S/C11H6F4N2O/c12-10(13)11(14,15)6-18-9-2-1-7(4-16)8(3-9)5-17/h1-3,10H,6H2 |
| InChIKey | GRGLGCUTWCKKOQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|