C17H10F4O3 — CID 21180057
2-(2,2,3,3-tetrafluoropropoxy)anthracene-9,10-dione (PubChem CID 21180057) has the molecular formula C17H10F4O3 and a molecular weight of 338.26 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxy)anthracene-9,10-dione.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 21180057 |
| Molecular Formula | C17H10F4O3 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxy)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(OCC(F)(F)C(F)F)ccc21 |
| InChI | InChI=1S/C17H10F4O3/c18-16(19)17(20,21)8-24-9-5-6-12-13(7-9)15(23)11-4-2-1-3-10(11)14(12)22/h1-7,16H,8H2 |
| InChIKey | JOSVAJBTDWZESL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|