C8H5F4N3O — CID 80510710
3-(2,2,3,3-tetrafluoropropoxy)pyridazine-4-carbonitrile (PubChem CID 80510710) has the molecular formula C8H5F4N3O and a molecular weight of 235.14 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropoxy)pyridazine-4-carbonitrile.
| Compound Name | 3-(2,2,3,3-tetrafluoropropoxy)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80510710 |
| Molecular Formula | C8H5F4N3O |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropoxy)pyridazine-4-carbonitrile |
| SMILES | N#Cc1ccnnc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H5F4N3O/c9-7(10)8(11,12)4-16-6-5(3-13)1-2-14-15-6/h1-2,7H,4H2 |
| InChIKey | GXLLDCZPIGHVEU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|