C9H5ClF4N2O — CID 83073911
2-chloro-6-(2,2,3,3-tetrafluoropropoxy)pyridine-4-carbonitrile (PubChem CID 83073911) has the molecular formula C9H5ClF4N2O and a molecular weight of 268.60 g/mol. Its IUPAC name is 2-chloro-6-(2,2,3,3-tetrafluoropropoxy)pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-(2,2,3,3-tetrafluoropropoxy)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83073911 |
| Molecular Formula | C9H5ClF4N2O |
| Molecular Weight | 268.60 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 2-chloro-6-(2,2,3,3-tetrafluoropropoxy)pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)nc(OCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C9H5ClF4N2O/c10-6-1-5(3-15)2-7(16-6)17-4-9(13,14)8(11)12/h1-2,8H,4H2 |
| InChIKey | PMMJCGLQNLWBFS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|