C15H5F5N2O — CID 102581377
4-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzene-1,2-dicarbonitrile (PubChem CID 102581377) has the molecular formula C15H5F5N2O and a molecular weight of 324.21 g/mol. Its IUPAC name is 4-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 102581377 |
| Molecular Formula | C15H5F5N2O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 4-[(2,3,4,5,6-pentafluorophenyl)methoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(OCc2c(F)c(F)c(F)c(F)c2F)cc1C#N |
| InChI | InChI=1S/C15H5F5N2O/c16-11-10(12(17)14(19)15(20)13(11)18)6-23-9-2-1-7(4-21)8(3-9)5-22/h1-3H,6H2 |
| InChIKey | DEIIPYNNRTVXQM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|