C26H12F10O3 — CID 141088240
1,2,3,4,5-pentafluoro-6-[[4-[4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenoxy]phenoxy]methyl]benzene (PubChem CID 141088240) has the molecular formula C26H12F10O3 and a molecular weight of 562.36 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[[4-[4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenoxy]phenoxy]methyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[[4-[4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenoxy]phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 141088240 |
| Molecular Formula | C26H12F10O3 |
| Molecular Weight | 562.36 g/mol |
| Exact Mass | 562.06 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[[4-[4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenoxy]phenoxy]methyl]benzene |
| SMILES | Fc1c(F)c(F)c(COc2ccc(Oc3ccc(OCc4c(F)c(F)c(F)c(F)c4F)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C26H12F10O3/c27-17-15(18(28)22(32)25(35)21(17)31)9-37-11-1-5-13(6-2-11)39-14-7-3-12(4-8-14)38-10-16-19(29)23(33)26(36)24(34)20(16)30/h1-8H,9-10H2 |
| InChIKey | PNIDUKNWLGFZPU-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.36 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|