C13H7BrCl2F2O — CID 106269934
1-bromo-3-[(3,4-dichlorophenoxy)methyl]-2,4-difluorobenzene (PubChem CID 106269934) has the molecular formula C13H7BrCl2F2O and a molecular weight of 368.00 g/mol. Its IUPAC name is 1-bromo-3-[(3,4-dichlorophenoxy)methyl]-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-[(3,4-dichlorophenoxy)methyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 106269934 |
| Molecular Formula | C13H7BrCl2F2O |
| Molecular Weight | 368.00 g/mol |
| Exact Mass | 365.90 |
| IUPAC Name | 1-bromo-3-[(3,4-dichlorophenoxy)methyl]-2,4-difluorobenzene |
| SMILES | Fc1ccc(Br)c(F)c1COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H7BrCl2F2O/c14-9-2-4-12(17)8(13(9)18)6-19-7-1-3-10(15)11(16)5-7/h1-5H,6H2 |
| InChIKey | JOWHNFPPSUBEKI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|