C16H15BrF2O — CID 106269980
1-bromo-2,4-difluoro-3-[(4-propylphenoxy)methyl]benzene (PubChem CID 106269980) has the molecular formula C16H15BrF2O and a molecular weight of 341.20 g/mol. Its IUPAC name is 1-bromo-2,4-difluoro-3-[(4-propylphenoxy)methyl]benzene.
| Compound Name | 1-bromo-2,4-difluoro-3-[(4-propylphenoxy)methyl]benzene |
|---|---|
| PubChem CID | 106269980 |
| Molecular Formula | C16H15BrF2O |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 1-bromo-2,4-difluoro-3-[(4-propylphenoxy)methyl]benzene |
| SMILES | CCCc1ccc(OCc2c(F)ccc(Br)c2F)cc1 |
| InChI | InChI=1S/C16H15BrF2O/c1-2-3-11-4-6-12(7-5-11)20-10-13-15(18)9-8-14(17)16(13)19/h4-9H,2-3,10H2,1H3 |
| InChIKey | BVXFSQSBZRUIPB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|