C13H8BrF2IO — CID 106264107
1-bromo-2,4-difluoro-3-[(3-iodophenoxy)methyl]benzene (PubChem CID 106264107) has the molecular formula C13H8BrF2IO and a molecular weight of 425.01 g/mol. Its IUPAC name is 1-bromo-2,4-difluoro-3-[(3-iodophenoxy)methyl]benzene.
| Compound Name | 1-bromo-2,4-difluoro-3-[(3-iodophenoxy)methyl]benzene |
|---|---|
| PubChem CID | 106264107 |
| Molecular Formula | C13H8BrF2IO |
| Molecular Weight | 425.01 g/mol |
| Exact Mass | 423.88 |
| IUPAC Name | 1-bromo-2,4-difluoro-3-[(3-iodophenoxy)methyl]benzene |
| SMILES | Fc1ccc(Br)c(F)c1COc1cccc(I)c1 |
| InChI | InChI=1S/C13H8BrF2IO/c14-11-4-5-12(15)10(13(11)16)7-18-9-3-1-2-8(17)6-9/h1-6H,7H2 |
| InChIKey | ZPGFEZRAWSIKEU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.01 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|