C13H6Br2F4O — CID 106264121
1-bromo-3-[(5-bromo-2,3-difluorophenoxy)methyl]-2,4-difluorobenzene (PubChem CID 106264121) has the molecular formula C13H6Br2F4O and a molecular weight of 413.99 g/mol. Its IUPAC name is 1-bromo-3-[(5-bromo-2,3-difluorophenoxy)methyl]-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-[(5-bromo-2,3-difluorophenoxy)methyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 106264121 |
| Molecular Formula | C13H6Br2F4O |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 411.87 |
| IUPAC Name | 1-bromo-3-[(5-bromo-2,3-difluorophenoxy)methyl]-2,4-difluorobenzene |
| SMILES | Fc1cc(Br)cc(OCc2c(F)ccc(Br)c2F)c1F |
| InChI | InChI=1S/C13H6Br2F4O/c14-6-3-10(17)13(19)11(4-6)20-5-7-9(16)2-1-8(15)12(7)18/h1-4H,5H2 |
| InChIKey | NSLXTGKTHVACJW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|