C15H14BrF2NO — CID 106269112
2-[2-[(3-bromo-2,6-difluorophenyl)methoxy]phenyl]ethanamine (PubChem CID 106269112) has the molecular formula C15H14BrF2NO and a molecular weight of 342.18 g/mol. Its IUPAC name is 2-[2-[(3-bromo-2,6-difluorophenyl)methoxy]phenyl]ethanamine.
| Compound Name | 2-[2-[(3-bromo-2,6-difluorophenyl)methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 106269112 |
| Molecular Formula | C15H14BrF2NO |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-[2-[(3-bromo-2,6-difluorophenyl)methoxy]phenyl]ethanamine |
| SMILES | NCCc1ccccc1OCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H14BrF2NO/c16-12-5-6-13(17)11(15(12)18)9-20-14-4-2-1-3-10(14)7-8-19/h1-6H,7-9,19H2 |
| InChIKey | KDDQTHWCNNIOPN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|