C14H12BrF2NO — CID 106262816
3-[(3-bromo-2,6-difluorophenyl)methoxy]-2-methylaniline (PubChem CID 106262816) has the molecular formula C14H12BrF2NO and a molecular weight of 328.16 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methoxy]-2-methylaniline.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methoxy]-2-methylaniline |
|---|---|
| PubChem CID | 106262816 |
| Molecular Formula | C14H12BrF2NO |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methoxy]-2-methylaniline |
| SMILES | Cc1c(N)cccc1OCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H12BrF2NO/c1-8-12(18)3-2-4-13(8)19-7-9-11(16)6-5-10(15)14(9)17/h2-6H,7,18H2,1H3 |
| InChIKey | OVVHGVKBYNLRDV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|