C14H12BrF2NOS — CID 106273419
3-[(3-bromo-2,6-difluorophenyl)methylsulfinyl]-2-methylaniline (PubChem CID 106273419) has the molecular formula C14H12BrF2NOS and a molecular weight of 360.22 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methylsulfinyl]-2-methylaniline.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methylsulfinyl]-2-methylaniline |
|---|---|
| PubChem CID | 106273419 |
| Molecular Formula | C14H12BrF2NOS |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methylsulfinyl]-2-methylaniline |
| SMILES | Cc1c(N)cccc1S(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H12BrF2NOS/c1-8-12(18)3-2-4-13(8)20(19)7-9-11(16)6-5-10(15)14(9)17/h2-6H,7,18H2,1H3 |
| InChIKey | YTIZNILVDAXXOZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|