C9H10BrF2NOS — CID 106273380
2-[(3-bromo-2,6-difluorophenyl)methylsulfinyl]ethanamine (PubChem CID 106273380) has the molecular formula C9H10BrF2NOS and a molecular weight of 298.15 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methylsulfinyl]ethanamine.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfinyl]ethanamine |
|---|---|
| PubChem CID | 106273380 |
| Molecular Formula | C9H10BrF2NOS |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfinyl]ethanamine |
| SMILES | NCCS(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C9H10BrF2NOS/c10-7-1-2-8(11)6(9(7)12)5-15(14)4-3-13/h1-2H,3-5,13H2 |
| InChIKey | MWTJOFJKVNOXFZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|