C14H10BrClF2O2 — CID 106264375
[2-[(3-bromo-2,6-difluorophenyl)methoxy]-5-chlorophenyl]methanol (PubChem CID 106264375) has the molecular formula C14H10BrClF2O2 and a molecular weight of 363.59 g/mol. Its IUPAC name is [2-[(3-bromo-2,6-difluorophenyl)methoxy]-5-chlorophenyl]methanol.
| Compound Name | [2-[(3-bromo-2,6-difluorophenyl)methoxy]-5-chlorophenyl]methanol |
|---|---|
| PubChem CID | 106264375 |
| Molecular Formula | C14H10BrClF2O2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | [2-[(3-bromo-2,6-difluorophenyl)methoxy]-5-chlorophenyl]methanol |
| SMILES | OCc1cc(Cl)ccc1OCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H10BrClF2O2/c15-11-2-3-12(17)10(14(11)18)7-20-13-4-1-9(16)5-8(13)6-19/h1-5,19H,6-7H2 |
| InChIKey | AVQHXEHGUIZGGC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|