C14H9Br2F2NOS — CID 106264053
5-bromo-2-[(3-bromo-2,6-difluorophenyl)methoxy]benzenecarbothioamide (PubChem CID 106264053) has the molecular formula C14H9Br2F2NOS and a molecular weight of 437.10 g/mol. Its IUPAC name is 5-bromo-2-[(3-bromo-2,6-difluorophenyl)methoxy]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[(3-bromo-2,6-difluorophenyl)methoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 106264053 |
| Molecular Formula | C14H9Br2F2NOS |
| Molecular Weight | 437.10 g/mol |
| Exact Mass | 434.87 |
| IUPAC Name | 5-bromo-2-[(3-bromo-2,6-difluorophenyl)methoxy]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(Br)ccc1OCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H9Br2F2NOS/c15-7-1-4-12(8(5-7)14(19)21)20-6-9-11(17)3-2-10(16)13(9)18/h1-5H,6H2,(H2,19,21) |
| InChIKey | JKDQFYCQAKKICG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.10 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|