C14H9BrClF2NOS — CID 106264054
4-[(3-bromo-2,6-difluorophenyl)methoxy]-2-chlorobenzenecarbothioamide (PubChem CID 106264054) has the molecular formula C14H9BrClF2NOS and a molecular weight of 392.65 g/mol. Its IUPAC name is 4-[(3-bromo-2,6-difluorophenyl)methoxy]-2-chlorobenzenecarbothioamide.
| Compound Name | 4-[(3-bromo-2,6-difluorophenyl)methoxy]-2-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 106264054 |
| Molecular Formula | C14H9BrClF2NOS |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | 4-[(3-bromo-2,6-difluorophenyl)methoxy]-2-chlorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(OCc2c(F)ccc(Br)c2F)cc1Cl |
| InChI | InChI=1S/C14H9BrClF2NOS/c15-10-3-4-12(17)9(13(10)18)6-20-7-1-2-8(14(19)21)11(16)5-7/h1-5H,6H2,(H2,19,21) |
| InChIKey | SIJNNCQWXJFHNW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|